| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[TXT]](/icons/text.gif) | skincare.kws.txt | 2005-01-13 23:01 | 4.6K | |
| ![[TXT]](/icons/text.gif) | reaction.kws.txt | 2005-01-13 23:01 | 3.3K | |
| ![[TXT]](/icons/text.gif) | pennies.kws.txt | 2005-01-13 23:01 | 4.0K | |
| ![[TXT]](/icons/text.gif) | lube.kws.txt | 2005-01-13 23:01 | 5.1K | |
| ![[TXT]](/icons/text.gif) | disnex.kws.txt | 2005-01-13 23:01 | 4.8K | |
| ![[TXT]](/icons/text.gif) | disk_and.kws.txt | 2005-01-13 23:01 | 3.3K | |
| ![[TXT]](/icons/text.gif) | damn.kws.txt | 2005-01-13 23:01 | 3.8K | |
| ![[TXT]](/icons/text.gif) | buttafew.kws.txt | 2005-01-13 23:01 | 3.5K | |
| ![[TXT]](/icons/text.gif) | blase.kws.txt | 2005-01-13 23:01 | 5.0K | |
| ![[TXT]](/icons/text.gif) | baby_VIM.kws.txt | 2005-01-13 23:01 | 4.6K | |
| ![[TXT]](/icons/text.gif) | 101thing.kws.txt | 2005-01-13 23:01 | 5.1K | |